C22H24N2O5S — CID 4142709
methyl 2-[2-(3-butoxybenzoyl)imino-6-methoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 4142709) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is methyl 2-[2-(3-butoxybenzoyl)imino-6-methoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(3-butoxybenzoyl)imino-6-methoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4142709 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | methyl 2-[2-(3-butoxybenzoyl)imino-6-methoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCCCOc1cccc(C(=O)/N=c2\sc3cc(OC)ccc3n2CC(=O)OC)c1 |
| InChI | InChI=1S/C22H24N2O5S/c1-4-5-11-29-17-8-6-7-15(12-17)21(26)23-22-24(14-20(25)28-3)18-10-9-16(27-2)13-19(18)30-22/h6-10,12-13H,4-5,11,14H2,1-3H3/b23-22- |
| InChIKey | YIRKWIVTCWWLLR-FCQUAONHSA-N |
| XLogP | 3.80 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|