C18H24FNO3S — CID 4142944
N-[2-(cyclohexen-1-yl)ethyl]-3-[(2-fluorophenyl)methylsulfonyl]propanamide (PubChem CID 4142944) has the molecular formula C18H24FNO3S and a molecular weight of 353.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[(2-fluorophenyl)methylsulfonyl]propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(2-fluorophenyl)methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 4142944 |
| Molecular Formula | C18H24FNO3S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(2-fluorophenyl)methylsulfonyl]propanamide |
| SMILES | O=C(CCS(=O)(=O)Cc1ccccc1F)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H24FNO3S/c19-17-9-5-4-8-16(17)14-24(22,23)13-11-18(21)20-12-10-15-6-2-1-3-7-15/h4-6,8-9H,1-3,7,10-14H2,(H,20,21) |
| InChIKey | XRIGZYCGNPCLRF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|