C23H24N4O4S — CID 41429747
2-[[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one (PubChem CID 41429747) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is 2-[[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one.
| Compound Name | 2-[[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 41429747 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-[[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one |
| SMILES | CCOc1ccccc1-c1noc(CSc2nc3ccccc3c(=O)n2CCCOC)n1 |
| InChI | InChI=1S/C23H24N4O4S/c1-3-30-19-12-7-5-10-17(19)21-25-20(31-26-21)15-32-23-24-18-11-6-4-9-16(18)22(28)27(23)13-8-14-29-2/h4-7,9-12H,3,8,13-15H2,1-2H3 |
| InChIKey | SEIBKAGPCVAWLP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|