C25H29N5O2S — CID 41432650
2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]-N-phenyl-N-propan-2-ylacetamide (PubChem CID 41432650) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is 2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]-N-phenyl-N-propan-2-ylacetamide.
| Compound Name | 2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]-N-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 41432650 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]-N-phenyl-N-propan-2-ylacetamide |
| SMILES | CCCCCn1c(=O)c2ccccc2n2c(SCC(=O)N(c3ccccc3)C(C)C)nnc12 |
| InChI | InChI=1S/C25H29N5O2S/c1-4-5-11-16-28-23(32)20-14-9-10-15-21(20)30-24(28)26-27-25(30)33-17-22(31)29(18(2)3)19-12-7-6-8-13-19/h6-10,12-15,18H,4-5,11,16-17H2,1-3H3 |
| InChIKey | OTNGJWDIMLQVAG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 72.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|