C16H16ClN3O2 — CID 41433756
6-chloro-N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 41433756) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is 6-chloro-N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 41433756 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 6-chloro-N-methyl-N-[[4-(methylcarbamoyl)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(CN(C)C(=O)c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C16H16ClN3O2/c1-18-15(21)12-5-3-11(4-6-12)10-20(2)16(22)13-7-8-14(17)19-9-13/h3-9H,10H2,1-2H3,(H,18,21) |
| InChIKey | FHWBFGGEYMGJMM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|