About 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine
1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine (PubChem CID 41434471) has the molecular formula C7H6N4S
and a molecular weight of 178.22 g/mol. Its IUPAC name is 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine.
Molecular Properties
| Compound Name | 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine |
| PubChem CID | 41434471 |
| Molecular Formula | C7H6N4S |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine |
| SMILES | C(=Nc1ncn[nH]1)c1cccs1 |
| InChI | InChI=1S/C7H6N4S/c1-2-6(12-3-1)4-8-7-9-5-10-11-7/h1-5H,(H,9,10,11) |
| InChIKey | XQEXRKRDUJNHCM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine?
The IUPAC name of 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine (CID 41434471) is 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine.
What is the SMILES notation for 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine?
The canonical SMILES for 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine is C(=Nc1ncn[nH]1)c1cccs1.
What is the InChIKey of 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine?
The InChIKey is XQEXRKRDUJNHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4S/c1-2-6(12-3-1)4-8-7-9-5-10-11-7/h1-5H,(H,9,10,11).
What are the key properties of 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine?
1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine has a molecular weight of 178.22 g/mol, XLogP of 1.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thiophen-2-yl-N-(1H-1,2,4-triazol-5-yl)methanimine is sourced from PubChem (CID 41434471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).