C23H28N2O5 — CID 41436663
1,3-bis[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]urea (PubChem CID 41436663) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1,3-bis[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]urea.
| Compound Name | 1,3-bis[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]urea |
|---|---|
| PubChem CID | 41436663 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1,3-bis[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]urea |
| SMILES | O=C(Nc1ccc(OC[C@@H]2CCCO2)cc1)Nc1ccc(OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C23H28N2O5/c26-23(24-17-5-9-19(10-6-17)29-15-21-3-1-13-27-21)25-18-7-11-20(12-8-18)30-16-22-4-2-14-28-22/h5-12,21-22H,1-4,13-16H2,(H2,24,25,26)/t21-,22-/m0/s1 |
| InChIKey | ZCZJJZRILAJLLJ-VXKWHMMOSA-N |
| XLogP | 4.45 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |