C18H19N3O4S — CID 41437655
1-(1,3-benzothiazol-2-yl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea (PubChem CID 41437655) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 41437655 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[(3,4,5-trimethoxyphenyl)methyl]urea |
| SMILES | COc1cc(CNC(=O)Nc2nc3ccccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C18H19N3O4S/c1-23-13-8-11(9-14(24-2)16(13)25-3)10-19-17(22)21-18-20-12-6-4-5-7-15(12)26-18/h4-9H,10H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | NQSAXXRZVXXIQL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |