C22H29N3O3S — CID 41438320
N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]-3-(4-sulfamoylphenyl)propanamide (PubChem CID 41438320) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]-3-(4-sulfamoylphenyl)propanamide.
| Compound Name | N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]-3-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 41438320 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[[2-(piperidin-1-ylmethyl)phenyl]methyl]-3-(4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(CCC(=O)NCc2ccccc2CN2CCCCC2)cc1 |
| InChI | InChI=1S/C22H29N3O3S/c23-29(27,28)21-11-8-18(9-12-21)10-13-22(26)24-16-19-6-2-3-7-20(19)17-25-14-4-1-5-15-25/h2-3,6-9,11-12H,1,4-5,10,13-17H2,(H,24,26)(H2,23,27,28) |
| InChIKey | AQLSLLGXDMYZNQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |