C26H28ClN5 — CID 4144184
3-(4-chlorophenyl)-2,5-dimethyl-7-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]pyrazolo[1,5-a]pyrimidine (PubChem CID 4144184) has the molecular formula C26H28ClN5 and a molecular weight of 446.00 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2,5-dimethyl-7-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]pyrazolo[1,5-a]pyrimidine.
| Compound Name | 3-(4-chlorophenyl)-2,5-dimethyl-7-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 4144184 |
| Molecular Formula | C26H28ClN5 |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-(4-chlorophenyl)-2,5-dimethyl-7-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]pyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccc(N2CCN(c3cc(C)nc4c(-c5ccc(Cl)cc5)c(C)nn34)CC2C)cc1 |
| InChI | InChI=1S/C26H28ClN5/c1-17-5-11-23(12-6-17)31-14-13-30(16-19(31)3)24-15-18(2)28-26-25(20(4)29-32(24)26)21-7-9-22(27)10-8-21/h5-12,15,19H,13-14,16H2,1-4H3 |
| InChIKey | JIVCNVJAFGTIEH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|