C24H22N6O3 — CID 4144342
5-methyl-N-[1-[3-[(2-methylpyrazole-3-carbonyl)amino]phenyl]ethylideneamino]-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 4144342) has the molecular formula C24H22N6O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is 5-methyl-N-[1-[3-[(2-methylpyrazole-3-carbonyl)amino]phenyl]ethylideneamino]-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-[1-[3-[(2-methylpyrazole-3-carbonyl)amino]phenyl]ethylideneamino]-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 4144342 |
| Molecular Formula | C24H22N6O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 5-methyl-N-[1-[3-[(2-methylpyrazole-3-carbonyl)amino]phenyl]ethylideneamino]-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | CC(=NNC(=O)c1c(-c2ccccc2)noc1C)c1cccc(NC(=O)c2ccnn2C)c1 |
| InChI | InChI=1S/C24H22N6O3/c1-15(18-10-7-11-19(14-18)26-23(31)20-12-13-25-30(20)3)27-28-24(32)21-16(2)33-29-22(21)17-8-5-4-6-9-17/h4-14H,1-3H3,(H,26,31)(H,28,32) |
| InChIKey | DBBHSTHFSCZRBW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|