C18H18Cl2O2 — CID 4144347
2-(2,4-dichlorophenyl)-5,5-dimethyl-2-phenyl-1,3-dioxane (PubChem CID 4144347) has the molecular formula C18H18Cl2O2 and a molecular weight of 337.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5,5-dimethyl-2-phenyl-1,3-dioxane.
| Compound Name | 2-(2,4-dichlorophenyl)-5,5-dimethyl-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 4144347 |
| Molecular Formula | C18H18Cl2O2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5,5-dimethyl-2-phenyl-1,3-dioxane |
| SMILES | CC1(C)COC(c2ccccc2)(c2ccc(Cl)cc2Cl)OC1 |
| InChI | InChI=1S/C18H18Cl2O2/c1-17(2)11-21-18(22-12-17,13-6-4-3-5-7-13)15-9-8-14(19)10-16(15)20/h3-10H,11-12H2,1-2H3 |
| InChIKey | VPIILBDVRYJERZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |