C37H55NO6 — CID 4145176
ethyl N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate (PubChem CID 4145176) has the molecular formula C37H55NO6 and a molecular weight of 609.85 g/mol. Its IUPAC name is ethyl N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate.
| Compound Name | ethyl N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 4145176 |
| Molecular Formula | C37H55NO6 |
| Molecular Weight | 609.85 g/mol |
| Exact Mass | 609.40 |
| IUPAC Name | ethyl N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate |
| SMILES | CCOC(=O)N(CC1CCCO1)CC1(O)CCC2C34C=CC5(C=C3C(=O)C3CCCCC3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C37H55NO6/c1-4-43-32(41)38(23-27-11-8-20-44-27)24-36(42)17-14-30-34(36,3)16-13-29-33(2)15-12-26(39)21-35(33)18-19-37(29,30)28(22-35)31(40)25-9-6-5-7-10-25/h18-19,22,25-27,29-30,39,42H,4-17,20-21,23-24H2,1-3H3 |
| InChIKey | HHSCCPFNZYVBAS-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.85 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|