C15H16BrFN2O2 — CID 41453654
5-bromo-N-[(2R)-2-(dimethylamino)-2-(4-fluorophenyl)ethyl]furan-2-carboxamide (PubChem CID 41453654) has the molecular formula C15H16BrFN2O2 and a molecular weight of 355.21 g/mol. Its IUPAC name is 5-bromo-N-[(2R)-2-(dimethylamino)-2-(4-fluorophenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(2R)-2-(dimethylamino)-2-(4-fluorophenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 41453654 |
| Molecular Formula | C15H16BrFN2O2 |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 5-bromo-N-[(2R)-2-(dimethylamino)-2-(4-fluorophenyl)ethyl]furan-2-carboxamide |
| SMILES | CN(C)[C@@H](CNC(=O)c1ccc(Br)o1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H16BrFN2O2/c1-19(2)12(10-3-5-11(17)6-4-10)9-18-15(20)13-7-8-14(16)21-13/h3-8,12H,9H2,1-2H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | ZQZKFQMHNCMTRM-LBPRGKRZSA-N |
| XLogP | 3.21 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |