C23H30N2O — CID 41453775
N-[(2S)-4-phenylbutan-2-yl]-4-(piperidin-1-ylmethyl)benzamide (PubChem CID 41453775) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is N-[(2S)-4-phenylbutan-2-yl]-4-(piperidin-1-ylmethyl)benzamide.
| Compound Name | N-[(2S)-4-phenylbutan-2-yl]-4-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 41453775 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | N-[(2S)-4-phenylbutan-2-yl]-4-(piperidin-1-ylmethyl)benzamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)c1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C23H30N2O/c1-19(10-11-20-8-4-2-5-9-20)24-23(26)22-14-12-21(13-15-22)18-25-16-6-3-7-17-25/h2,4-5,8-9,12-15,19H,3,6-7,10-11,16-18H2,1H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | IWCBZEPRTKURTH-IBGZPJMESA-N |
| XLogP | 4.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |