About 4-pyridin-4-ylmorpholine
4-pyridin-4-ylmorpholine (PubChem CID 4145413) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 4-pyridin-4-ylmorpholine.
Molecular Properties
| Compound Name | 4-pyridin-4-ylmorpholine |
| PubChem CID | 4145413 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 4-pyridin-4-ylmorpholine |
| SMILES | c1cc(N2CCOCC2)ccn1 |
| InChI | InChI=1S/C9H12N2O/c1-3-10-4-2-9(1)11-5-7-12-8-6-11/h1-4H,5-8H2 |
| InChIKey | QJWQYVJVCXMTJP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyridin-4-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-4-ylmorpholine?
The IUPAC name of 4-pyridin-4-ylmorpholine (CID 4145413) is 4-pyridin-4-ylmorpholine.
What is the SMILES notation for 4-pyridin-4-ylmorpholine?
The canonical SMILES for 4-pyridin-4-ylmorpholine is c1cc(N2CCOCC2)ccn1.
What is the InChIKey of 4-pyridin-4-ylmorpholine?
The InChIKey is QJWQYVJVCXMTJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-3-10-4-2-9(1)11-5-7-12-8-6-11/h1-4H,5-8H2.
What are the key properties of 4-pyridin-4-ylmorpholine?
4-pyridin-4-ylmorpholine has a molecular weight of 164.21 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-4-ylmorpholine is sourced from PubChem (CID 4145413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).