C17H26N6O2 — CID 41454829
(4S)-1-ethyl-3,4,9-trimethyl-7-(3-methylbutyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 41454829) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is (4S)-1-ethyl-3,4,9-trimethyl-7-(3-methylbutyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | (4S)-1-ethyl-3,4,9-trimethyl-7-(3-methylbutyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 41454829 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (4S)-1-ethyl-3,4,9-trimethyl-7-(3-methylbutyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CCN1N=C(C)[C@H](C)n2c1nc1c2c(=O)n(CCC(C)C)c(=O)n1C |
| InChI | InChI=1S/C17H26N6O2/c1-7-22-16-18-14-13(23(16)12(5)11(4)19-22)15(24)21(9-8-10(2)3)17(25)20(14)6/h10,12H,7-9H2,1-6H3/t12-/m0/s1 |
| InChIKey | NKTKXTKSNNWLRK-LBPRGKRZSA-N |
| XLogP | 1.72 |
| TPSA | 77.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |