C22H27N3O — CID 41456404
2-[(2S)-2-phenylpyrrolidin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 41456404) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-[(2S)-2-phenylpyrrolidin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(2S)-2-phenylpyrrolidin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 41456404 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 2-[(2S)-2-phenylpyrrolidin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN1CCC[C@H]1c1ccccc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C22H27N3O/c26-22(17-25-16-6-9-21(25)18-7-2-1-3-8-18)23-19-10-12-20(13-11-19)24-14-4-5-15-24/h1-3,7-8,10-13,21H,4-6,9,14-17H2,(H,23,26)/t21-/m0/s1 |
| InChIKey | OPAPWNLHGCJZSF-NRFANRHFSA-N |
| XLogP | 4.06 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|