About N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide
N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide (PubChem CID 4146165) has the molecular formula C16H19N3O2S
and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide.
Molecular Properties
| Compound Name | N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide |
| PubChem CID | 4146165 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(NN(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-13-9-11-15(12-10-13)22(20,21)18-16(17-19(2)3)14-7-5-4-6-8-14/h4-12H,1-3H3,(H,17,18) |
| InChIKey | DYJXNGXCRDOMBP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide?
The IUPAC name of N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide (CID 4146165) is N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide.
What is the SMILES notation for N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide?
The canonical SMILES for N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide is Cc1ccc(S(=O)(=O)N=C(NN(C)C)c2ccccc2)cc1.
What is the InChIKey of N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide?
The InChIKey is DYJXNGXCRDOMBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O2S/c1-13-9-11-15(12-10-13)22(20,21)18-16(17-19(2)3)14-7-5-4-6-8-14/h4-12H,1-3H3,(H,17,18).
What are the key properties of N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide?
N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide has a molecular weight of 317.41 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(dimethylamino)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide is sourced from PubChem (CID 4146165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).