C21H25N2O3S+ — CID 4146373
3-(3,4-dimethoxyphenyl)-1-(2-methylphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol (PubChem CID 4146373) has the molecular formula C21H25N2O3S+ and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-(2-methylphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-(2-methylphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
|---|---|
| PubChem CID | 4146373 |
| Molecular Formula | C21H25N2O3S+ |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-(2-methylphenyl)-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
| SMILES | COc1ccc(C2(O)CN(c3ccccc3C)C3=[N+]2CCCS3)cc1OC |
| InChI | InChI=1S/C21H25N2O3S/c1-15-7-4-5-8-17(15)22-14-21(24,23-11-6-12-27-20(22)23)16-9-10-18(25-2)19(13-16)26-3/h4-5,7-10,13,24H,6,11-12,14H2,1-3H3/q+1 |
| InChIKey | ZWMQTVKWERPDMV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|