C19H20BrN2O+ — CID 4146719
3-(4-bromophenyl)-1-phenyl-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol (PubChem CID 4146719) has the molecular formula C19H20BrN2O+ and a molecular weight of 372.29 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-phenyl-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol.
| Compound Name | 3-(4-bromophenyl)-1-phenyl-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
|---|---|
| PubChem CID | 4146719 |
| Molecular Formula | C19H20BrN2O+ |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 3-(4-bromophenyl)-1-phenyl-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
| SMILES | OC1(c2ccc(Br)cc2)CN(c2ccccc2)C2=[N+]1CCCC2 |
| InChI | InChI=1S/C19H20BrN2O/c20-16-11-9-15(10-12-16)19(23)14-21(17-6-2-1-3-7-17)18-8-4-5-13-22(18)19/h1-3,6-7,9-12,23H,4-5,8,13-14H2/q+1 |
| InChIKey | HHAFHWTVFOUYQC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|