C25H30N2O6S — CID 4146930
ethyl 10-[2-(3,4-dimethoxyphenyl)ethyl]-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate (PubChem CID 4146930) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is ethyl 10-[2-(3,4-dimethoxyphenyl)ethyl]-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate.
| Compound Name | ethyl 10-[2-(3,4-dimethoxyphenyl)ethyl]-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
|---|---|
| PubChem CID | 4146930 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | ethyl 10-[2-(3,4-dimethoxyphenyl)ethyl]-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
| SMILES | CCOC(=O)C1C2NC(=S)N(CCc3ccc(OC)c(OC)c3)C1(C)Oc1c(OC)cccc12 |
| InChI | InChI=1S/C25H30N2O6S/c1-6-32-23(28)20-21-16-8-7-9-18(30-4)22(16)33-25(20,2)27(24(34)26-21)13-12-15-10-11-17(29-3)19(14-15)31-5/h7-11,14,20-21H,6,12-13H2,1-5H3,(H,26,34) |
| InChIKey | CZWAGQQDVQLCFY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|