C20H16N2O4 — CID 4147427
1-amino-5-anilino-4,8-dihydroxy-4a,9a-dihydroanthracene-9,10-dione (PubChem CID 4147427) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-amino-5-anilino-4,8-dihydroxy-4a,9a-dihydroanthracene-9,10-dione.
| Compound Name | 1-amino-5-anilino-4,8-dihydroxy-4a,9a-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 4147427 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-amino-5-anilino-4,8-dihydroxy-4a,9a-dihydroanthracene-9,10-dione |
| SMILES | NC1=CC=C(O)C2C(=O)c3c(Nc4ccccc4)ccc(O)c3C(=O)C12 |
| InChI | InChI=1S/C20H16N2O4/c21-11-6-8-13(23)17-15(11)19(25)18-14(24)9-7-12(16(18)20(17)26)22-10-4-2-1-3-5-10/h1-9,15,17,22-24H,21H2 |
| InChIKey | PZPYTMCCNSGMNY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|