C17H23N3O3S — CID 4147519
3-methyl-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]but-2-enamide (PubChem CID 4147519) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 3-methyl-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]but-2-enamide.
| Compound Name | 3-methyl-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 4147519 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-methyl-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]but-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1cccc(S(=O)(=O)NC2=NCCCCC2)c1 |
| InChI | InChI=1S/C17H23N3O3S/c1-13(2)11-17(21)19-14-7-6-8-15(12-14)24(22,23)20-16-9-4-3-5-10-18-16/h6-8,11-12H,3-5,9-10H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | YCUKUXHXLGOAGG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|