About 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide
2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide (PubChem CID 4147575) has the molecular formula C26H25N3O3
and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide |
| PubChem CID | 4147575 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cc(Nc3ccccc3)nc3ccccc23)cc1OC |
| InChI | InChI=1S/C26H25N3O3/c1-31-23-13-12-18(16-24(23)32-2)14-15-27-26(30)21-17-25(28-19-8-4-3-5-9-19)29-22-11-7-6-10-20(21)22/h3-13,16-17H,14-15H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | UWZSNGIPSVLSRT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide?
The IUPAC name of 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide (CID 4147575) is 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide.
What is the SMILES notation for 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide?
The canonical SMILES for 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide is COc1ccc(CCNC(=O)c2cc(Nc3ccccc3)nc3ccccc23)cc1OC.
What is the InChIKey of 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide?
The InChIKey is UWZSNGIPSVLSRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O3/c1-31-23-13-12-18(16-24(23)32-2)14-15-27-26(30)21-17-25(28-19-8-4-3-5-9-19)29-22-11-7-6-10-20(21)22/h3-13,16-17H,14-15H2,1-2H3,(H,27,30)(H,28,29).
What are the key properties of 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide?
2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide has a molecular weight of 427.50 g/mol, XLogP of 4.97, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-N-[2-(3,4-dimethoxyphenyl)ethyl]quinoline-4-carboxamide is sourced from PubChem (CID 4147575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).