About [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate
[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate (PubChem CID 4147834) has the molecular formula C20H20N2O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate.
Molecular Properties
| Compound Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate |
| PubChem CID | 4147834 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)OCC(=O)N2c3ccccc3CC2C)c1 |
| InChI | InChI=1S/C20H20N2O4/c1-13-10-15-6-3-4-9-18(15)22(13)19(24)12-26-20(25)16-7-5-8-17(11-16)21-14(2)23/h3-9,11,13H,10,12H2,1-2H3,(H,21,23) |
| InChIKey | XBGWVGJRXPGGMF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate?
The IUPAC name of [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate (CID 4147834) is [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate.
What is the SMILES notation for [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate?
The canonical SMILES for [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate is CC(=O)Nc1cccc(C(=O)OCC(=O)N2c3ccccc3CC2C)c1.
What is the InChIKey of [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate?
The InChIKey is XBGWVGJRXPGGMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4/c1-13-10-15-6-3-4-9-18(15)22(13)19(24)12-26-20(25)16-7-5-8-17(11-16)21-14(2)23/h3-9,11,13H,10,12H2,1-2H3,(H,21,23).
What are the key properties of [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate?
[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate has a molecular weight of 352.39 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 3-acetamidobenzoate is sourced from PubChem (CID 4147834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).