C21H15Br2N3S2 — CID 4148158
10,12-bis(4-bromophenyl)-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 4148158) has the molecular formula C21H15Br2N3S2 and a molecular weight of 533.31 g/mol. Its IUPAC name is 10,12-bis(4-bromophenyl)-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 10,12-bis(4-bromophenyl)-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 4148158 |
| Molecular Formula | C21H15Br2N3S2 |
| Molecular Weight | 533.31 g/mol |
| Exact Mass | 530.91 |
| IUPAC Name | 10,12-bis(4-bromophenyl)-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | Nc1ncnc2sc3c(c12)CC(c1ccc(Br)cc1)SC3c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H15Br2N3S2/c22-13-5-1-11(2-6-13)16-9-15-17-20(24)25-10-26-21(17)28-19(15)18(27-16)12-3-7-14(23)8-4-12/h1-8,10,16,18H,9H2,(H2,24,25,26) |
| InChIKey | DOJSKNXJDYQWRX-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.31 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |