C24H24N4O3S — CID 41483133
N-[1-[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]piperidin-4-yl]benzamide (PubChem CID 41483133) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[1-[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 41483133 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[1-[2-(2-benzamido-1,3-thiazol-4-yl)acetyl]piperidin-4-yl]benzamide |
| SMILES | O=C(Nc1nc(CC(=O)N2CCC(NC(=O)c3ccccc3)CC2)cs1)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O3S/c29-21(15-20-16-32-24(26-20)27-23(31)18-9-5-2-6-10-18)28-13-11-19(12-14-28)25-22(30)17-7-3-1-4-8-17/h1-10,16,19H,11-15H2,(H,25,30)(H,26,27,31) |
| InChIKey | LNNKTRXJBHEPHI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |