C17H16N2O3 — CID 4148717
4-nitro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 4148717) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-nitro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | 4-nitro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 4148717 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-nitro-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | O=C(NC1CCCc2ccccc21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N2O3/c20-17(13-8-10-14(11-9-13)19(21)22)18-16-7-3-5-12-4-1-2-6-15(12)16/h1-2,4,6,8-11,16H,3,5,7H2,(H,18,20) |
| InChIKey | IRICJGWSFQWTSX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|