About dodecanoate
dodecanoate (PubChem CID 4149208) has the molecular formula C12H23O2-
and a molecular weight of 199.31 g/mol. Its IUPAC name is dodecanoate.
Molecular Properties
| Compound Name | dodecanoate |
| PubChem CID | 4149208 |
| Molecular Formula | C12H23O2- |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/p-1 |
| InChIKey | POULHZVOKOAJMA-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecanoate?
The IUPAC name of dodecanoate (CID 4149208) is dodecanoate.
What is the SMILES notation for dodecanoate?
The canonical SMILES for dodecanoate is CCCCCCCCCCCC(=O)[O-].
What is the InChIKey of dodecanoate?
The InChIKey is POULHZVOKOAJMA-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/p-1.
What are the key properties of dodecanoate?
dodecanoate has a molecular weight of 199.31 g/mol, XLogP of 2.66, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodecanoate is sourced from PubChem (CID 4149208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).