C20H21ClN2O2 — CID 41492257
(3S)-6-chloro-N-(4-pyrrolidin-1-ylphenyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 41492257) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is (3S)-6-chloro-N-(4-pyrrolidin-1-ylphenyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3S)-6-chloro-N-(4-pyrrolidin-1-ylphenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 41492257 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (3S)-6-chloro-N-(4-pyrrolidin-1-ylphenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)[C@@H]1COc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C20H21ClN2O2/c21-16-3-8-19-14(12-16)11-15(13-25-19)20(24)22-17-4-6-18(7-5-17)23-9-1-2-10-23/h3-8,12,15H,1-2,9-11,13H2,(H,22,24)/t15-/m0/s1 |
| InChIKey | YUWDJHQVVJLEEL-HNNXBMFYSA-N |
| XLogP | 4.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|