C25H37NO2 — CID 41493464
(2R)-1-(1-adamantyloxy)-3-(4-benzylpiperidin-1-yl)propan-2-ol (PubChem CID 41493464) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (2R)-1-(1-adamantyloxy)-3-(4-benzylpiperidin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(1-adamantyloxy)-3-(4-benzylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 41493464 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (2R)-1-(1-adamantyloxy)-3-(4-benzylpiperidin-1-yl)propan-2-ol |
| SMILES | O[C@@H](COC12CC3CC(CC(C3)C1)C2)CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H37NO2/c27-24(18-28-25-14-21-11-22(15-25)13-23(12-21)16-25)17-26-8-6-20(7-9-26)10-19-4-2-1-3-5-19/h1-5,20-24,27H,6-18H2/t21?,22?,23?,24-,25?/m1/s1 |
| InChIKey | VJUUVEOHITUAOC-NIRFSVBPSA-N |
| XLogP | 4.29 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |