C36H27ClFN3O5 — CID 4149381
6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxynaphthalen-1-yl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4149381) has the molecular formula C36H27ClFN3O5 and a molecular weight of 636.08 g/mol. Its IUPAC name is 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxynaphthalen-1-yl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxynaphthalen-1-yl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4149381 |
| Molecular Formula | C36H27ClFN3O5 |
| Molecular Weight | 636.08 g/mol |
| Exact Mass | 635.16 |
| IUPAC Name | 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxynaphthalen-1-yl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1NC(=O)C2C1CC=C1C2CC2C(=O)N(Nc3ccc(F)cc3)C(=O)C2(c2ccc(Cl)cc2)C1c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C36H27ClFN3O5/c37-19-7-5-18(6-8-19)36-28(34(45)41(35(36)46)40-21-11-9-20(38)10-12-21)17-27-25(13-14-26-30(27)33(44)39-32(26)43)31(36)24-15-16-29(42)23-4-2-1-3-22(23)24/h1-13,15-16,26-28,30-31,40,42H,14,17H2,(H,39,43,44) |
| InChIKey | WVOLEJATLOAAAD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.08 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|