C22H24N4O6S2 — CID 4150142
N-(4-methoxy-3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)-4-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 4150142) has the molecular formula C22H24N4O6S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-(4-methoxy-3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)-4-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(4-methoxy-3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)-4-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 4150142 |
| Molecular Formula | C22H24N4O6S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | N-(4-methoxy-3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)-4-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | COc1cc([N+](=O)[O-])cc2s/c(=N\C(=O)c3ccc(S(=O)(=O)N4CCCCC4C)cc3)n(C)c12 |
| InChI | InChI=1S/C22H24N4O6S2/c1-14-6-4-5-11-25(14)34(30,31)17-9-7-15(8-10-17)21(27)23-22-24(2)20-18(32-3)12-16(26(28)29)13-19(20)33-22/h7-10,12-14H,4-6,11H2,1-3H3/b23-22- |
| InChIKey | QNZUJHYEXQYREZ-FCQUAONHSA-N |
| XLogP | 3.46 |
| TPSA | 124.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|