C24H25N5OS2 — CID 4150312
N-[3-[benzyl(methyl)amino]propyl]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]quinoline-4-carboxamide (PubChem CID 4150312) has the molecular formula C24H25N5OS2 and a molecular weight of 463.63 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]quinoline-4-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4150312 |
| Molecular Formula | C24H25N5OS2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]quinoline-4-carboxamide |
| SMILES | Cc1nnc(Sc2cc(C(=O)NCCCN(C)Cc3ccccc3)c3ccccc3n2)s1 |
| InChI | InChI=1S/C24H25N5OS2/c1-17-27-28-24(31-17)32-22-15-20(19-11-6-7-12-21(19)26-22)23(30)25-13-8-14-29(2)16-18-9-4-3-5-10-18/h3-7,9-12,15H,8,13-14,16H2,1-2H3,(H,25,30) |
| InChIKey | YMRQJQQOGHFIDE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|