C23H30ClN5O3S — CID 4150594
1-[[2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylsulfanyl]acetyl]amino]-3-(4-methoxyphenyl)urea (PubChem CID 4150594) has the molecular formula C23H30ClN5O3S and a molecular weight of 492.05 g/mol. Its IUPAC name is 1-[[2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylsulfanyl]acetyl]amino]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[[2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylsulfanyl]acetyl]amino]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 4150594 |
| Molecular Formula | C23H30ClN5O3S |
| Molecular Weight | 492.05 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 1-[[2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylsulfanyl]acetyl]amino]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NNC(=O)CSCCCN2CCN(c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C23H30ClN5O3S/c1-32-21-8-6-19(7-9-21)25-23(31)27-26-22(30)17-33-15-3-10-28-11-13-29(14-12-28)20-5-2-4-18(24)16-20/h2,4-9,16H,3,10-15,17H2,1H3,(H,26,30)(H2,25,27,31) |
| InChIKey | RZDMUVQTAVMBGZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.05 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|