C19H14BrN5O4 — CID 4150796
1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 4150796) has the molecular formula C19H14BrN5O4 and a molecular weight of 456.26 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4150796 |
| Molecular Formula | C19H14BrN5O4 |
| Molecular Weight | 456.26 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | Cc1cc(-n2c(O)c(/C=N/c3ccc4[nH]c(=O)[nH]c4c3)c(=O)[nH]c2=O)ccc1Br |
| InChI | InChI=1S/C19H14BrN5O4/c1-9-6-11(3-4-13(9)20)25-17(27)12(16(26)24-19(25)29)8-21-10-2-5-14-15(7-10)23-18(28)22-14/h2-8,27H,1H3,(H2,22,23,28)(H,24,26,29)/b21-8+ |
| InChIKey | TWAMBNXVWXVXMN-ODCIPOBUSA-N |
| XLogP | 2.22 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|