C44H66N2O4 — CID 4151573
1-(1-adamantylmethyl)-1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-ylurea (PubChem CID 4151573) has the molecular formula C44H66N2O4 and a molecular weight of 687.02 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-ylurea.
| Compound Name | 1-(1-adamantylmethyl)-1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 4151573 |
| Molecular Formula | C44H66N2O4 |
| Molecular Weight | 687.02 g/mol |
| Exact Mass | 686.50 |
| IUPAC Name | 1-(1-adamantylmethyl)-1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N(CC12CC3CC(CC(C3)C1)C2)CC1(O)CCC2C34C=CC5(C=C3C(=O)C3CCCCC3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C44H66N2O4/c1-28(2)45-38(49)46(26-41-21-29-18-30(22-41)20-31(19-29)23-41)27-43(50)15-12-36-40(43,4)14-11-35-39(3)13-10-33(47)24-42(39)16-17-44(35,36)34(25-42)37(48)32-8-6-5-7-9-32/h16-17,25,28-33,35-36,47,50H,5-15,18-24,26-27H2,1-4H3,(H,45,49) |
| InChIKey | WFZCKLUPZPWWGK-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.02 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|