C38H36N4Si2 — CID 4152947
3,6-dimethyl-1,2,3,4,5,6-hexakis-phenyl-1,2,4,5,3,6-tetrazadisilinane (PubChem CID 4152947) has the molecular formula C38H36N4Si2 and a molecular weight of 604.91 g/mol. Its IUPAC name is 3,6-dimethyl-1,2,3,4,5,6-hexakis-phenyl-1,2,4,5,3,6-tetrazadisilinane.
| Compound Name | 3,6-dimethyl-1,2,3,4,5,6-hexakis-phenyl-1,2,4,5,3,6-tetrazadisilinane |
|---|---|
| PubChem CID | 4152947 |
| Molecular Formula | C38H36N4Si2 |
| Molecular Weight | 604.91 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 3,6-dimethyl-1,2,3,4,5,6-hexakis-phenyl-1,2,4,5,3,6-tetrazadisilinane |
| SMILES | C[Si]1(c2ccccc2)N(c2ccccc2)N(c2ccccc2)[Si](C)(c2ccccc2)N(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C38H36N4Si2/c1-43(37-29-17-7-18-30-37)39(33-21-9-3-10-22-33)41(35-25-13-5-14-26-35)44(2,38-31-19-8-20-32-38)42(36-27-15-6-16-28-36)40(43)34-23-11-4-12-24-34/h3-32H,1-2H3 |
| InChIKey | NDQPWFARELMLLC-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.91 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|