About N-prop-2-enylhexanamide
N-prop-2-enylhexanamide (PubChem CID 4153372) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is N-prop-2-enylhexanamide.
Molecular Properties
| Compound Name | N-prop-2-enylhexanamide |
| PubChem CID | 4153372 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | N-prop-2-enylhexanamide |
| SMILES | C=CCNC(=O)CCCCC |
| InChI | InChI=1S/C9H17NO/c1-3-5-6-7-9(11)10-8-4-2/h4H,2-3,5-8H2,1H3,(H,10,11) |
| InChIKey | LOZLMTIKLHNPLV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enylhexanamide?
The IUPAC name of N-prop-2-enylhexanamide (CID 4153372) is N-prop-2-enylhexanamide.
What is the SMILES notation for N-prop-2-enylhexanamide?
The canonical SMILES for N-prop-2-enylhexanamide is C=CCNC(=O)CCCCC.
What is the InChIKey of N-prop-2-enylhexanamide?
The InChIKey is LOZLMTIKLHNPLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-3-5-6-7-9(11)10-8-4-2/h4H,2-3,5-8H2,1H3,(H,10,11).
What are the key properties of N-prop-2-enylhexanamide?
N-prop-2-enylhexanamide has a molecular weight of 155.24 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enylhexanamide is sourced from PubChem (CID 4153372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).