C11H18O2 — CID 4153577
8a-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalene-1,6-diol (PubChem CID 4153577) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 8a-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalene-1,6-diol.
| Compound Name | 8a-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalene-1,6-diol |
|---|---|
| PubChem CID | 4153577 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 8a-methyl-2,3,4,6,7,8-hexahydro-1H-naphthalene-1,6-diol |
| SMILES | CC12CCC(O)C=C1CCCC2O |
| InChI | InChI=1S/C11H18O2/c1-11-6-5-9(12)7-8(11)3-2-4-10(11)13/h7,9-10,12-13H,2-6H2,1H3 |
| InChIKey | GEMVWTFQNXYPRO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|