About 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine
5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine (PubChem CID 4153654) has the molecular formula C16H13N5O2
and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine |
| PubChem CID | 4153654 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(Nc2ccccc2)nc1Nc1ccccc1 |
| InChI | InChI=1S/C16H13N5O2/c22-21(23)14-11-17-16(19-13-9-5-2-6-10-13)20-15(14)18-12-7-3-1-4-8-12/h1-11H,(H2,17,18,19,20) |
| InChIKey | YKPWNVMTPYXVRJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine?
The IUPAC name of 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine (CID 4153654) is 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine?
The canonical SMILES for 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine is O=[N+]([O-])c1cnc(Nc2ccccc2)nc1Nc1ccccc1.
What is the InChIKey of 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine?
The InChIKey is YKPWNVMTPYXVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5O2/c22-21(23)14-11-17-16(19-13-9-5-2-6-10-13)20-15(14)18-12-7-3-1-4-8-12/h1-11H,(H2,17,18,19,20).
What are the key properties of 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine?
5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine has a molecular weight of 307.31 g/mol, XLogP of 3.87, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine is sourced from PubChem (CID 4153654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).