About 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one
5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one (PubChem CID 4154150) has the molecular formula C22H24BrNO3
and a molecular weight of 430.34 g/mol. Its IUPAC name is 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one.
Molecular Properties
| Compound Name | 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
| PubChem CID | 4154150 |
| Molecular Formula | C22H24BrNO3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
| SMILES | CCCCN1C(=O)C(O)(CC(=O)c2ccc(C)cc2C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C22H24BrNO3/c1-4-5-10-24-19-9-7-16(23)12-18(19)22(27,21(24)26)13-20(25)17-8-6-14(2)11-15(17)3/h6-9,11-12,27H,4-5,10,13H2,1-3H3 |
| InChIKey | NFHRWJMXNCWJAE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one?
The IUPAC name of 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one (CID 4154150) is 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one.
What is the SMILES notation for 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one?
The canonical SMILES for 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one is CCCCN1C(=O)C(O)(CC(=O)c2ccc(C)cc2C)c2cc(Br)ccc21.
What is the InChIKey of 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one?
The InChIKey is NFHRWJMXNCWJAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24BrNO3/c1-4-5-10-24-19-9-7-16(23)12-18(19)22(27,21(24)26)13-20(25)17-8-6-14(2)11-15(17)3/h6-9,11-12,27H,4-5,10,13H2,1-3H3.
What are the key properties of 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one?
5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one has a molecular weight of 430.34 g/mol, XLogP of 4.67, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-butyl-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one is sourced from PubChem (CID 4154150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).