About 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid
4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid (PubChem CID 4154798) has the molecular formula C16H20N2O5S
and a molecular weight of 352.41 g/mol. Its IUPAC name is 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid |
| PubChem CID | 4154798 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid |
| SMILES | CCOc1cc2[nH]c(=S)n(CCCC(=O)O)c(=O)c2cc1OCC |
| InChI | InChI=1S/C16H20N2O5S/c1-3-22-12-8-10-11(9-13(12)23-4-2)17-16(24)18(15(10)21)7-5-6-14(19)20/h8-9H,3-7H2,1-2H3,(H,17,24)(H,19,20) |
| InChIKey | DXZBEZCWWPHNIN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid?
The IUPAC name of 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid (CID 4154798) is 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid.
What is the SMILES notation for 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid?
The canonical SMILES for 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid is CCOc1cc2[nH]c(=S)n(CCCC(=O)O)c(=O)c2cc1OCC.
What is the InChIKey of 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid?
The InChIKey is DXZBEZCWWPHNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O5S/c1-3-22-12-8-10-11(9-13(12)23-4-2)17-16(24)18(15(10)21)7-5-6-14(19)20/h8-9H,3-7H2,1-2H3,(H,17,24)(H,19,20).
What are the key properties of 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid?
4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid has a molecular weight of 352.41 g/mol, XLogP of 2.72, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,7-diethoxy-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoic acid is sourced from PubChem (CID 4154798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).