About 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine
7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine (PubChem CID 4154842) has the molecular formula C7H8N4OS
and a molecular weight of 196.23 g/mol. Its IUPAC name is 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine |
| PubChem CID | 4154842 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine |
| SMILES | CCOc1nc(C)nc2snnc12 |
| InChI | InChI=1S/C7H8N4OS/c1-3-12-6-5-7(13-11-10-5)9-4(2)8-6/h3H2,1-2H3 |
| InChIKey | WUZLBDVMVMNVKS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine?
The IUPAC name of 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine (CID 4154842) is 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine?
The canonical SMILES for 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine is CCOc1nc(C)nc2snnc12.
What is the InChIKey of 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine?
The InChIKey is WUZLBDVMVMNVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4OS/c1-3-12-6-5-7(13-11-10-5)9-4(2)8-6/h3H2,1-2H3.
What are the key properties of 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine?
7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine has a molecular weight of 196.23 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-5-methylthiadiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 4154842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).