C26H28N2O5 — CID 4155350
[3-(2-methylphenoxy)-2-[(4-methylphenyl)carbamoyloxy]propyl] N-(4-methylphenyl)carbamate (PubChem CID 4155350) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is [3-(2-methylphenoxy)-2-[(4-methylphenyl)carbamoyloxy]propyl] N-(4-methylphenyl)carbamate.
| Compound Name | [3-(2-methylphenoxy)-2-[(4-methylphenyl)carbamoyloxy]propyl] N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 4155350 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [3-(2-methylphenoxy)-2-[(4-methylphenyl)carbamoyloxy]propyl] N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)OCC(COc2ccccc2C)OC(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O5/c1-18-8-12-21(13-9-18)27-25(29)32-17-23(16-31-24-7-5-4-6-20(24)3)33-26(30)28-22-14-10-19(2)11-15-22/h4-15,23H,16-17H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | JXVVANZVQFXXMP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |