C23H39N3O2 — CID 4155509
2-N,2-N,6-N,6-N-tetrakis(2-methylpropyl)pyridine-2,6-dicarboxamide (PubChem CID 4155509) has the molecular formula C23H39N3O2 and a molecular weight of 389.58 g/mol. Its IUPAC name is 2-N,2-N,6-N,6-N-tetrakis(2-methylpropyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,2-N,6-N,6-N-tetrakis(2-methylpropyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 4155509 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | 2-N,2-N,6-N,6-N-tetrakis(2-methylpropyl)pyridine-2,6-dicarboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1cccc(C(=O)N(CC(C)C)CC(C)C)n1 |
| InChI | InChI=1S/C23H39N3O2/c1-16(2)12-25(13-17(3)4)22(27)20-10-9-11-21(24-20)23(28)26(14-18(5)6)15-19(7)8/h9-11,16-19H,12-15H2,1-8H3 |
| InChIKey | FYCOXABEMDICGJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |