C25H29N3O4S — CID 4156591
3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6,7-diethoxy-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 4156591) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is 3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6,7-diethoxy-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6,7-diethoxy-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 4156591 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6,7-diethoxy-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CCOc1cc2[nH]c(=S)n(CCCC(=O)N3CCc4ccccc4C3)c(=O)c2cc1OCC |
| InChI | InChI=1S/C25H29N3O4S/c1-3-31-21-14-19-20(15-22(21)32-4-2)26-25(33)28(24(19)30)12-7-10-23(29)27-13-11-17-8-5-6-9-18(17)16-27/h5-6,8-9,14-15H,3-4,7,10-13,16H2,1-2H3,(H,26,33) |
| InChIKey | NIGKGTAPPJQPJZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|