About N-benzhydrylpropanamide
N-benzhydrylpropanamide (PubChem CID 4156638) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is N-benzhydrylpropanamide.
Molecular Properties
| Compound Name | N-benzhydrylpropanamide |
| PubChem CID | 4156638 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-benzhydrylpropanamide |
| SMILES | CCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO/c1-2-15(18)17-16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,16H,2H2,1H3,(H,17,18) |
| InChIKey | WFJCUVNCWKUMSC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzhydrylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzhydrylpropanamide?
The IUPAC name of N-benzhydrylpropanamide (CID 4156638) is N-benzhydrylpropanamide.
What is the SMILES notation for N-benzhydrylpropanamide?
The canonical SMILES for N-benzhydrylpropanamide is CCC(=O)NC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-benzhydrylpropanamide?
The InChIKey is WFJCUVNCWKUMSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO/c1-2-15(18)17-16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,16H,2H2,1H3,(H,17,18).
What are the key properties of N-benzhydrylpropanamide?
N-benzhydrylpropanamide has a molecular weight of 239.32 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzhydrylpropanamide is sourced from PubChem (CID 4156638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).