C18H19F3N2O2 — CID 4157867
1,7,7-trimethyl-4-[4-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydroquinazoline-2,5-dione (PubChem CID 4157867) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is 1,7,7-trimethyl-4-[4-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydroquinazoline-2,5-dione.
| Compound Name | 1,7,7-trimethyl-4-[4-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 4157867 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1,7,7-trimethyl-4-[4-(trifluoromethyl)phenyl]-3,4,6,8-tetrahydroquinazoline-2,5-dione |
| SMILES | CN1C(=O)NC(c2ccc(C(F)(F)F)cc2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C18H19F3N2O2/c1-17(2)8-12-14(13(24)9-17)15(22-16(25)23(12)3)10-4-6-11(7-5-10)18(19,20)21/h4-7,15H,8-9H2,1-3H3,(H,22,25) |
| InChIKey | GPGODZUAJFJQAG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |